List of plants having phytochemicals: Tormentic acid
| Sl. No | Plant Name |
|---|---|
| 1 | Jacaranda acutifolia |
| 2 | Ludwigia octovalvis |
| 3 | Rubus barberi |
| 4 | Rubus moluccanus |
| 5 | Vitex peduncularis |
Details of Tormentic acid
| IUPAC | (1R,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-1,10,11-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Canonical Smiles | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1(C)O)C)C(=O)O |
| Inchi | OXVUXGFZHDKYLS-BLIWDXROSA-N |
| PubChem ID | 73193 |
| Smiles | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Class | Ursane and Taraxastane triterpenoids |
| Super Class | Triterpenoids |
| Pathways | Terpenoids |