List of plants having phytochemicals: Dioctyl phthalate
| Sl. No | Plant Name |
|---|---|
| 1 | Arbutus unedo |
| 2 | Grewia microcos |
| 3 | Launaea residifolia |
Details of Dioctyl phthalate
| IUPAC | dioctyl benzene-1,2-dicarboxylate |
| Canonical Smiles | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC |
| Inchi | MQIUGAXCHLFZKX-UHFFFAOYSA-N |
| PubChem ID | 8346 |
| Smiles | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC |
ERROR opening https://cactus.nci.nih.gov/chemical/structure/CCCCCCCCOC%28%3DO%29c1ccccc1C%28%3DO%29OCCCCCCCC/file?format=sdf&get3d=True -- CCCCCCCCOC%28%3DO%29c1ccccc1C%28%3DO%29OCCCCCCCC could not be loaded.
| Class | Shikimic acids and derivatives, Simple phenolic acids |
| Super Class | Phenolic acids (C6-C1) |
| Pathways | Shikimates and Phenylpropanoids |
