List of plants having phytochemicals: Aloe emodin
| Sl. No | Plant Name |
|---|---|
| 1 | Chamaecrista absus |
| 2 | Emex spinosa |
| 3 | Rumex chalepensis |
| 4 | Rumex dentatus |
| 5 | Rumex patientia |
| 6 | Zingerber officinale |
Details of Aloe emodin
| IUPAC | 1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| Canonical Smiles | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)CO |
| Inchi | YDQWDHRMZQUTBA-UHFFFAOYSA-N |
| PubChem ID | 10207 |
| Smiles | O=Cc1cc(O)c2c(O)c3c(O)cccc3c(O)c2c1 |
| Class | Anthraquinones and anthrones |
| Super Class | Polycyclic aromatic polyketides |
| Pathways | Polyketides |