List of plants having phytochemicals: ALBANOL-A
| Sl. No | Plant Name |
|---|---|
| 1 | Avicennia alba |
| 2 | Caltha alba |
| 3 | Canella alba |
| 4 | Datura alba |
| 5 | Eclipta alba |
| 6 | Lippia alba |
| 7 | Melilotus alba |
| 8 | Nymphaea alba |
Details of ALBANOL-A
| IUPAC | (1R,9S,13S)-1-(2,4-dihydroxyphenyl)-17-(6-hydroxy-1-benzofuran-2-yl)-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,11,14,16,18-heptaene-5,15-diol |
| Canonical Smiles | CC1=CC2C3C(C1)C4=C(C=C(C=C4)O)OC3(OC5=CC(=CC(=C25)O)C6=CC7=C(O6)C=C(C=C7)O)C8=C(C=C(C=C8)O)O |
| Inchi | MJJWBJFYYRAYKU-WLKQUGLZSA-N |
| PubChem ID | 44567218 |
| Smiles | CC1=CC2c3c(O)cc(-c4cc5ccc(O)cc5o4)cc3OC3(c4ccc(O)cc4O)Oc4cc(O)ccc4C(C1)C23 |
| Class | 2-arylbenzofurans |
| Super Class | Isoflavonoids |
| Pathways | Shikimates and Phenylpropanoids |