List of plants having phytochemicals: ALBANIN-G
| Sl. No | Plant Name |
|---|---|
| 1 | Avicennia alba |
| 2 | Caltha alba |
| 3 | Canella alba |
| 4 | Datura alba |
| 5 | Eclipta alba |
| 6 | Lippia alba |
| 7 | Melilotus alba |
| 8 | Nymphaea alba |
Details of ALBANIN-G
| IUPAC | 8-[(1S,6S)-6-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3-methylbut-2-enyl)chromen-4-one |
| Canonical Smiles | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C(=C(C=C3)O)CC=C(C)C)O)C4=C(C=C(C5=C4OC(=C(C5=O)CC=C(C)C)C6=C(C=C(C=C6)O)O)O)O |
| Inchi | DKBPTKFKCCNXNH-IEVFXKOJSA-N |
| PubChem ID | 5384731 |
| Smiles | CC(C)=CCc1c(O)ccc(C(=O)C2C(c3c(O)cc(O)c4c(=O)c(CC=C(C)C)c(-c5ccc(O)cc5O)oc34)C=C(C)CC2c2ccc(O)cc2O)c1O |
| Class | Flavones |
| Super Class | Flavonoids |
| Pathways | Shikimates and Phenylpropanoids |