List of plants having phytochemicals: 1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester
| Sl. No | Plant Name |
|---|---|
| 1 | Cadaba trifoliata |
| 2 | Gratiola monnieri |
Details of 1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester
| IUPAC | 2-(2-ethylhexoxycarbonyl)benzoic acid |
| Canonical Smiles | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)O |
| Inchi | DJDSLBVSSOQSLW-UHFFFAOYSA-N |
| PubChem ID | 20393 |
| Smiles | CCCCC(CC)COC(=O)c1ccccc1C(=O)O |
| Class | Shikimic acids and derivatives, Simple phenolic acids |
| Super Class | Phenolic acids (C6-C1) |
| Pathways | Shikimates and Phenylpropanoids |
